Difference between revisions of "CPD-10806"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10267 == * common-name: ** decanoyl-coa * molecular-weight: ** 917.754 * inchi-key: ** cnkjphsefdpydb-hsjnekgzsa-j * smiles: ** ccccc...")
(Created page with "Category:metabolite == Metabolite CPD-10806 == * common-name: ** 4-hydroxy-2-nonenal * molecular-weight: ** 156.224 * inchi-key: ** jvjfiqyahpmbbx-fnorwqnlsa-n * smiles: *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10267 ==
+
== Metabolite CPD-10806 ==
 
* common-name:
 
* common-name:
** decanoyl-coa
+
** 4-hydroxy-2-nonenal
 
* molecular-weight:
 
* molecular-weight:
** 917.754
+
** 156.224
 
* inchi-key:
 
* inchi-key:
** cnkjphsefdpydb-hsjnekgzsa-j
+
** jvjfiqyahpmbbx-fnorwqnlsa-n
 
* smiles:
 
* smiles:
** cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cccccc(o)[ch]=cc=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13615]]
+
* [[RXN-13673]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13614]]
 
* [[RXN-14274]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=decanoyl-coa}}
+
{{#set: common-name=4-hydroxy-2-nonenal}}
{{#set: molecular-weight=917.754}}
+
{{#set: molecular-weight=156.224}}
{{#set: inchi-key=inchikey=cnkjphsefdpydb-hsjnekgzsa-j}}
+
{{#set: inchi-key=inchikey=jvjfiqyahpmbbx-fnorwqnlsa-n}}

Latest revision as of 19:34, 17 March 2021

Metabolite CPD-10806

  • common-name:
    • 4-hydroxy-2-nonenal
  • molecular-weight:
    • 156.224
  • inchi-key:
    • jvjfiqyahpmbbx-fnorwqnlsa-n
  • smiles:
    • cccccc(o)[ch]=cc=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality