Difference between revisions of "CPD-10806"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CARBOXYMETHYL-HYDROXYPHENYLPROPCOA == * common_name: ** 2-carboxymethyl-3-hydroxyphenylpropanoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)...")
(Created page with "Category:metabolite == Metabolite CPD-10806 == * common-name: ** 4-hydroxy-2-nonenal * molecular-weight: ** 156.224 * inchi-key: ** jvjfiqyahpmbbx-fnorwqnlsa-n * smiles: *...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CARBOXYMETHYL-HYDROXYPHENYLPROPCOA ==
+
== Metabolite CPD-10806 ==
* common_name:
+
* common-name:
** 2-carboxymethyl-3-hydroxyphenylpropanoyl-coa
+
** 4-hydroxy-2-nonenal
 +
* molecular-weight:
 +
** 156.224
 +
* inchi-key:
 +
** jvjfiqyahpmbbx-fnorwqnlsa-n
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c(cc([o-])=o)c(o)c1(=cc=cc=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** cccccc(o)[ch]=cc=o
* inchi_key:
 
** inchikey=dvsqfplmolprdu-acxvelpgsa-i
 
* molecular_weight:
 
** 968.692   
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-905]]
+
* [[RXN-13673]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-902]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common_name=2-carboxymethyl-3-hydroxyphenylpropanoyl-coa}}
+
{{#set: common-name=4-hydroxy-2-nonenal}}
{{#set: inchi_key=inchikey=dvsqfplmolprdu-acxvelpgsa-i}}
+
{{#set: molecular-weight=156.224}}
{{#set: molecular_weight=968.692    }}
+
{{#set: inchi-key=inchikey=jvjfiqyahpmbbx-fnorwqnlsa-n}}

Latest revision as of 19:34, 17 March 2021

Metabolite CPD-10806

  • common-name:
    • 4-hydroxy-2-nonenal
  • molecular-weight:
    • 156.224
  • inchi-key:
    • jvjfiqyahpmbbx-fnorwqnlsa-n
  • smiles:
    • cccccc(o)[ch]=cc=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality