Difference between revisions of "CPD-15326"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-ALLO-THREONINE == * common-name: ** l-allo-threonine * molecular-weight: ** 119.12 * inchi-key: ** ayfvyjqapqtccc-hrfvkafmsa-n * smiles...") |
(Created page with "Category:metabolite == Metabolite CPD-15326 == * common-name: ** 2-oxo-4-phenylbutanoate * molecular-weight: ** 177.179 * inchi-key: ** ppkaimdmnwbokn-uhfffaoysa-m * smile...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-15326 == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-oxo-4-phenylbutanoate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 177.179 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ppkaimdmnwbokn-uhfffaoysa-m |
* smiles: | * smiles: | ||
− | ** | + | ** c(=o)([o-])c(=o)ccc1(c=cc=cc=1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14467]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14467]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-oxo-4-phenylbutanoate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=177.179}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ppkaimdmnwbokn-uhfffaoysa-m}} |
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite CPD-15326
- common-name:
- 2-oxo-4-phenylbutanoate
- molecular-weight:
- 177.179
- inchi-key:
- ppkaimdmnwbokn-uhfffaoysa-m
- smiles:
- c(=o)([o-])c(=o)ccc1(c=cc=cc=1)