Difference between revisions of "FORMATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite URATE == * common-name: ** urate * molecular-weight: ** 168.112 * inchi-key: ** lehotffkmjeonl-uhfffaoysa-n * smiles: ** c12(nc(=o)nc=1c(...")
(Created page with "Category:metabolite == Metabolite FORMATE == * common-name: ** formate * molecular-weight: ** 45.018 * inchi-key: ** bdagihxwwsansr-uhfffaoysa-m * smiles: ** [ch]([o-])=o...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite URATE ==
+
== Metabolite FORMATE ==
 
* common-name:
 
* common-name:
** urate
+
** formate
 
* molecular-weight:
 
* molecular-weight:
** 168.112
+
** 45.018
 
* inchi-key:
 
* inchi-key:
** lehotffkmjeonl-uhfffaoysa-n
+
** bdagihxwwsansr-uhfffaoysa-m
 
* smiles:
 
* smiles:
** c12(nc(=o)nc=1c(=o)nc(=o)n2)
+
** [ch]([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-901]]
+
* [[1.2.1.2-RXN]]
* [[URATE-OXIDASE-RXN]]
+
* [[FORMATETHFLIG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-901]]
+
* [[1.2.1.2-RXN]]
* [[XANTHINE-OXIDASE-RXN]]
+
* [[3.5.1.27-RXN]]
 +
* [[3.5.1.88-RXN]]
 +
* [[DIOHBUTANONEPSYN-RXN]]
 +
* [[FORMATETHFLIG-RXN]]
 +
* [[FORMYLTHFDEFORMYL-RXN]]
 +
* [[GTP-CYCLOHYDRO-I-RXN]]
 +
* [[GTP-CYCLOHYDRO-II-RXN]]
 +
* [[KETOBUTFORMLY-RXN]]
 +
* [[R147-RXN]]
 +
* [[RXN-11881]]
 +
* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=urate}}
+
{{#set: common-name=formate}}
{{#set: molecular-weight=168.112}}
+
{{#set: molecular-weight=45.018}}
{{#set: inchi-key=inchikey=lehotffkmjeonl-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=bdagihxwwsansr-uhfffaoysa-m}}

Latest revision as of 19:34, 17 March 2021

Metabolite FORMATE

  • common-name:
    • formate
  • molecular-weight:
    • 45.018
  • inchi-key:
    • bdagihxwwsansr-uhfffaoysa-m
  • smiles:
    • [ch]([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality