Difference between revisions of "N-ALPHA-ACETYLORNITHINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACETYL-ETCETERA-L-ASPARAGINE == * common-name: ** n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine * molecular-weight: ** 335.313 * inchi...")
(Created page with "Category:metabolite == Metabolite N-ALPHA-ACETYLORNITHINE == * common-name: ** n-acetyl-l-ornithine * molecular-weight: ** 174.199 * inchi-key: ** jrlgpaxaghmnol-lurjtmies...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACETYL-ETCETERA-L-ASPARAGINE ==
+
== Metabolite N-ALPHA-ACETYLORNITHINE ==
 
* common-name:
 
* common-name:
** n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine
+
** n-acetyl-l-ornithine
 
* molecular-weight:
 
* molecular-weight:
** 335.313
+
** 174.199
 
* inchi-key:
 
* inchi-key:
** yttrpbwemmpysw-hrrfrdkfsa-n
+
** jrlgpaxaghmnol-lurjtmiesa-n
 
* smiles:
 
* smiles:
** cc(=o)nc1(c(o)c(o)c(co)oc(nc(=o)cc([n+])c(=o)[o-])1)
+
** cc(=o)nc(ccc[n+])c(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.5.1.26-RXN]]
+
* [[ACETYLORNDEACET-RXN]]
 +
* [[ACETYLORNTRANSAM-RXN]]
 +
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ACETYLORNDEACET-RXN]]
 +
* [[ACETYLORNTRANSAM-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine}}
+
{{#set: common-name=n-acetyl-l-ornithine}}
{{#set: molecular-weight=335.313}}
+
{{#set: molecular-weight=174.199}}
{{#set: inchi-key=inchikey=yttrpbwemmpysw-hrrfrdkfsa-n}}
+
{{#set: inchi-key=inchikey=jrlgpaxaghmnol-lurjtmiesa-n}}

Latest revision as of 19:35, 17 March 2021

Metabolite N-ALPHA-ACETYLORNITHINE

  • common-name:
    • n-acetyl-l-ornithine
  • molecular-weight:
    • 174.199
  • inchi-key:
    • jrlgpaxaghmnol-lurjtmiesa-n
  • smiles:
    • cc(=o)nc(ccc[n+])c(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality