Difference between revisions of "2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Reduced-flavodoxins == * common_name: ** a reduced flavodoxin == Reaction(s) known to consume the compound == == Reaction(s) known to pro...")
(Created page with "Category:metabolite == Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET == * common-name: ** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * molecular-wei...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Reduced-flavodoxins ==
+
== Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET ==
* common_name:
+
* common-name:
** a reduced flavodoxin
+
** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
 +
* molecular-weight:
 +
** 597.259
 +
* inchi-key:
 +
** htjxtkbiuvfuar-xhibxcghsa-j
 +
* smiles:
 +
** cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-302]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FLAVONADPREDUCT-RXN]]
+
* [[2.7.1.148-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common_name=a reduced flavodoxin}}
+
{{#set: common-name=2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
 +
{{#set: molecular-weight=597.259}}
 +
{{#set: inchi-key=inchikey=htjxtkbiuvfuar-xhibxcghsa-j}}

Latest revision as of 19:35, 17 March 2021

Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET

  • common-name:
    • 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
  • molecular-weight:
    • 597.259
  • inchi-key:
    • htjxtkbiuvfuar-xhibxcghsa-j
  • smiles:
    • cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality