Difference between revisions of "2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10262 == * common-name: ** (2e)-octadec-2-enoyl-coa * molecular-weight: ** 1027.953 * inchi-key: ** nbccuihohukbmk-zddafbbhsa-j * smi...") |
(Created page with "Category:metabolite == Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET == * common-name: ** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * molecular-wei...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET == |
* common-name: | * common-name: | ||
− | ** ( | + | ** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 597.259 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** htjxtkbiuvfuar-xhibxcghsa-j |
* smiles: | * smiles: | ||
− | ** | + | ** cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-302]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2.7.1.148-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=597.259}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=htjxtkbiuvfuar-xhibxcghsa-j}} |
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET
- common-name:
- 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
- molecular-weight:
- 597.259
- inchi-key:
- htjxtkbiuvfuar-xhibxcghsa-j
- smiles:
- cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o