Difference between revisions of "METHYLARSONITE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-D-GALACTURONATE == * common-name: ** udp-α-d-galacturonate * molecular-weight: ** 577.265 * inchi-key: ** hdyanyhvcapmjv-gxnrkq...")
(Created page with "Category:metabolite == Metabolite METHYLARSONITE == * common-name: ** methylarsonite * molecular-weight: ** 123.971 * inchi-key: ** oxbirpqqkcqwgv-uhfffaoysa-n * smiles: *...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-D-GALACTURONATE ==
+
== Metabolite METHYLARSONITE ==
 
* common-name:
 
* common-name:
** udp-α-d-galacturonate
+
** methylarsonite
 
* molecular-weight:
 
* molecular-weight:
** 577.265
+
** 123.971
 
* inchi-key:
 
* inchi-key:
** hdyanyhvcapmjv-gxnrkqdosa-k
+
** oxbirpqqkcqwgv-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)([o-])oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3))
+
** c[as](o)o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
+
* [[2.1.1.138-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-α-d-galacturonate}}
+
{{#set: common-name=methylarsonite}}
{{#set: molecular-weight=577.265}}
+
{{#set: molecular-weight=123.971}}
{{#set: inchi-key=inchikey=hdyanyhvcapmjv-gxnrkqdosa-k}}
+
{{#set: inchi-key=inchikey=oxbirpqqkcqwgv-uhfffaoysa-n}}

Latest revision as of 19:35, 17 March 2021

Metabolite METHYLARSONITE

  • common-name:
    • methylarsonite
  • molecular-weight:
    • 123.971
  • inchi-key:
    • oxbirpqqkcqwgv-uhfffaoysa-n
  • smiles:
    • c[as](o)o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality