Difference between revisions of "ADP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite METHYLARSONITE == * common-name: ** methylarsonite * molecular-weight: ** 123.971 * inchi-key: ** oxbirpqqkcqwgv-uhfffaoysa-n * smiles: *...")
 
(Created page with "Category:metabolite == Metabolite ADP == * common-name: ** adp * molecular-weight: ** 424.18 * inchi-key: ** xtwytfmlzfpyci-kqynxxcusa-k * smiles: ** c(c3(c(c(c(n2(c1(=c(c...")
 
(3 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite METHYLARSONITE ==
+
== Metabolite ADP ==
 
* common-name:
 
* common-name:
−
** methylarsonite
+
** adp
 
* molecular-weight:
 
* molecular-weight:
−
** 123.971
+
** 424.18
 
* inchi-key:
 
* inchi-key:
−
** oxbirpqqkcqwgv-uhfffaoysa-n
+
** xtwytfmlzfpyci-kqynxxcusa-k
 
* smiles:
 
* smiles:
−
** c[as](o)o
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])[o-])([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[2.1.1.138-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[2.7.11.19-RXN]]
 +
* [[2.7.11.20-RXN]]
 +
* [[2.7.11.24-RXN]]
 +
* [[2.7.11.25-RXN]]
 +
* [[2.7.12.1-RXN]]
 +
* [[2.7.12.2-RXN]]
 +
* [[2.7.4.10-RXN]]
 +
* [[3.6.3.8-RXN]]
 +
* [[5.99.1.3-RXN]]
 +
* [[ACETYLGLUTKIN-RXN]]
 +
* [[ADENYL-KIN-RXN]]
 +
* [[ADENYLYLSULFKIN-RXN]]
 +
* [[ADPREDUCT-RXN]]
 +
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 +
* [[ATPSYN-RXN]]
 +
* [[CREATINE-KINASE-RXN]]
 +
* [[ExchangeSeed-ADP]]
 +
* [[FORMATETHFLIG-RXN]]
 +
* [[GALACTOKIN-RXN]]
 +
* [[GLYCEROL-KIN-RXN]]
 +
* [[GUANYL-KIN-RXN]]
 +
* [[HEXOKINASE-RXN]]
 +
* [[MEVALONATE-KINASE-RXN]]
 +
* [[PEPDEPHOS-RXN]]
 +
* [[PHOSGLYPHOS-RXN]]
 +
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 +
* [[PHOSPHORIBULOKINASE-RXN]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
* [[RNA-POLYMERASE-SUBUNIT-KINASE-RXN]]
 +
* [[RXN-10862]]
 +
* [[RXN-11832]]
 +
* [[RXN-14120]]
 +
* [[RXN-14196]]
 +
* [[RXN-14228]]
 +
* [[RXN-14906]]
 +
* [[RXN-4305]]
 +
* [[RXN0-747]]
 +
* [[SHIKIMATE-KINASE-RXN]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[TAU-PROTEIN-KINASE-RXN]]
 +
* [[TransportSeed-ADP]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN]]
 +
* [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]]
 +
* [[2.7.1.127-RXN]]
 +
* [[2.7.1.133-RXN]]
 +
* [[2.7.1.134-RXN]]
 +
* [[2.7.1.139-RXN]]
 +
* [[2.7.1.140-RXN]]
 +
* [[2.7.1.148-RXN]]
 +
* [[2.7.1.149-RXN]]
 +
* [[2.7.1.150-RXN]]
 +
* [[2.7.1.152-RXN]]
 +
* [[2.7.1.153-RXN]]
 +
* [[2.7.1.154-RXN]]
 +
* [[2.7.1.68-RXN]]
 +
* [[2.7.10.1-RXN]]
 +
* [[2.7.11.19-RXN]]
 +
* [[2.7.11.2-RXN]]
 +
* [[2.7.11.20-RXN]]
 +
* [[2.7.11.24-RXN]]
 +
* [[2.7.11.25-RXN]]
 +
* [[2.7.11.30-RXN]]
 +
* [[2.7.12.1-RXN]]
 +
* [[2.7.12.2-RXN]]
 +
* [[2.7.13.3-RXN]]
 +
* [[2.7.4.10-RXN]]
 +
* [[2.7.4.24-RXN]]
 +
* [[3.6.3.1-RXN]]
 +
* [[3.6.3.16-RXN]]
 +
* [[3.6.3.23-RXN]]
 +
* [[3.6.3.35-RXN]]
 +
* [[3.6.3.41-RXN]]
 +
* [[3.6.3.43-RXN]]
 +
* [[3.6.3.44-RXN]]
 +
* [[3.6.3.6-RXN]]
 +
* [[3.6.3.8-RXN]]
 +
* [[3.6.3.9-RXN]]
 +
* [[3.6.4.3-RXN]]
 +
* [[3.6.4.4-RXN]]
 +
* [[3.6.4.5-RXN]]
 +
* [[5-FORMYL-THF-CYCLO-LIGASE-RXN]]
 +
* [[5-METHYLTHIORIBOSE-KINASE-RXN]]
 +
* [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]]
 +
* [[5.99.1.3-RXN]]
 +
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 +
* [[6.3.2.25-RXN]]
 +
* [[6.3.5.7-RXN]]
 +
* [[6PFRUCTPHOS-RXN]]
 +
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 +
* [[ACETYLGLUTKIN-RXN]]
 +
* [[ADENOSINE-KINASE-RXN]]
 +
* [[ADENYL-KIN-RXN]]
 +
* [[ADENYLYLSULFKIN-RXN]]
 +
* [[AIRS-RXN]]
 +
* [[ASPARTATEKIN-RXN]]
 +
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 +
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 +
* [[ATPASE-RXN]]
 +
* [[ATPSYN-RXN]]
 +
* [[BIOTIN-CARBOXYL-RXN]]
 +
* [[CARBPSYN-RXN]]
 +
* [[CDPKIN-RXN]]
 +
* [[CREATINE-KINASE-RXN]]
 +
* [[CTPSYN-RXN]]
 +
* [[CYTIKIN-RXN]]
 +
* [[DADPKIN-RXN]]
 +
* [[DCDPKIN-RXN]]
 +
* [[DEOXYADENYLATE-KINASE-RXN]]
 +
* [[DEPHOSPHOCOAKIN-RXN]]
 +
* [[DETHIOBIOTIN-SYN-RXN]]
 +
* [[DGDPKIN-RXN]]
 +
* [[DIACYLGLYKIN-RXN]]
 +
* [[DIHYDROFOLATESYNTH-RXN]]
 +
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
 +
* [[DTDPKIN-RXN]]
 +
* [[DTMPKI-RXN]]
 +
* [[DUDPKIN-RXN]]
 +
* [[ETHANOLAMINE-KINASE-RXN]]
 +
* [[ExchangeSeed-ADP]]
 +
* [[FGAMSYN-RXN]]
 +
* [[FOLYLPOLYGLUTAMATESYNTH-RXN]]
 +
* [[FORMATETHFLIG-RXN]]
 +
* [[FORMYLTHFGLUSYNTH-RXN]]
 +
* [[FRUCTOKINASE-RXN]]
 +
* [[FUCOKINASE-RXN]]
 +
* [[GALACTOKIN-RXN]]
 +
* [[GDPKIN-RXN]]
 +
* [[GLUCOKIN-RXN]]
 +
* [[GLUTAMINESYN-RXN]]
 +
* [[GLUTATHIONE-SYN-RXN]]
 +
* [[GLUTCYSLIG-RXN]]
 +
* [[GLUTKIN-RXN]]
 +
* [[GLYCEROL-KIN-RXN]]
 +
* [[GLYCERONE-KINASE-RXN]]
 +
* [[GLYRIBONUCSYN-RXN]]
 +
* [[GMKALT-RXN]]
 +
* [[GUANYL-KIN-RXN]]
 +
* [[HEXOKINASE-RXN]]
 +
* [[HOMOSERKIN-RXN]]
 +
* [[MANNKIN-RXN]]
 +
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 +
* [[MEVALONATE-KINASE-RXN]]
 +
* [[NAD-KIN-RXN]]
 +
* [[NADH-KINASE-RXN]]
 +
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
 +
* [[NUCLEOSIDE-DIP-KIN-RXN]]
 +
* [[NUCLEOSIDE-PHOSPHATE-KINASE-RXN]]
 +
* [[PANTOTHENATE-KIN-RXN]]
 +
* [[PEPCARBOXYKIN-RXN]]
 +
* [[PHOSGLYPHOS-RXN]]
 +
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 +
* [[PHOSPHORIBULOKINASE-RXN]]
 +
* [[PNKIN-RXN]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
* [[PROTEIN-KINASE-RXN]]
 +
* [[PSEUDOURIDINE-KINASE-RXN]]
 +
* [[PYRAMKIN-RXN]]
 +
* [[PYRIDOXKIN-RXN]]
 +
* [[PYRIMSYN3-RXN]]
 +
* [[PYRUVATE-CARBOXYLASE-RXN]]
 +
* [[RIBOFLAVINKIN-RXN]]
 +
* [[RIBOKIN-RXN]]
 +
* [[RNA-POLYMERASE-SUBUNIT-KINASE-RXN]]
 +
* [[RXN-10971]]
 +
* [[RXN-10972]]
 +
* [[RXN-10973]]
 +
* [[RXN-10974]]
 +
* [[RXN-10979]]
 +
* [[RXN-11832]]
 +
* [[RXN-12002]]
 +
* [[RXN-12056]]
 +
* [[RXN-13202]]
 +
* [[RXN-14074]]
 +
* [[RXN-14120]]
 +
* [[RXN-14196]]
 +
* [[RXN-14223]]
 +
* [[RXN-14228]]
 +
* [[RXN-14325]]
 +
* [[RXN-14391]]
 +
* [[RXN-14906]]
 +
* [[RXN-15005]]
 +
* [[RXN-16909]]
 +
* [[RXN-4941]]
 +
* [[RXN-7163]]
 +
* [[RXN-7913]]
 +
* [[RXN-8443]]
 +
* [[RXN0-2921]]
 +
* [[RXN0-5055]]
 +
* [[RXN1F-20]]
 +
* [[RXN1G-4355]]
 +
* [[SAICARSYN-RXN]]
 +
* [[SHIKIMATE-KINASE-RXN]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[TAU-PROTEIN-KINASE-RXN]]
 +
* [[TRANS-RXN0-162]]
 +
* [[TransportSeed-ADP]]
 +
* [[UDPKIN-RXN]]
 +
* [[URIDINEKIN-RXN]]
 +
* [[XYLULOKIN-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=methylarsonite}}
+
{{#set: common-name=adp}}
−
{{#set: molecular-weight=123.971}}
+
{{#set: molecular-weight=424.18}}
−
{{#set: inchi-key=inchikey=oxbirpqqkcqwgv-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=xtwytfmlzfpyci-kqynxxcusa-k}}

Latest revision as of 19:35, 17 March 2021

Metabolite ADP

  • common-name:
    • adp
  • molecular-weight:
    • 424.18
  • inchi-key:
    • xtwytfmlzfpyci-kqynxxcusa-k
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])[o-])([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=ADP&oldid=49358"