Difference between revisions of "Cellular-Retinol-Binding-Proteins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3Z-PHYTOCHROMOBILIN == * common-name: ** (3z)-phytochromobilin * molecular-weight: ** 582.655 * inchi-key: ** dkmlmzvdtgoegu-aikfxvfzsa-l...")
(Created page with "Category:metabolite == Metabolite Cellular-Retinol-Binding-Proteins == * common-name: ** a cellular-retinol-binding protein == Reaction(s) known to consume the compound ==...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite 3Z-PHYTOCHROMOBILIN ==
+
== Metabolite Cellular-Retinol-Binding-Proteins ==
 
* common-name:
 
* common-name:
−
** (3z)-phytochromobilin
+
** a cellular-retinol-binding protein
−
* molecular-weight:
 
−
** 582.655
 
−
* inchi-key:
 
−
** dkmlmzvdtgoegu-aikfxvfzsa-l
 
−
* smiles:
 
−
** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[1.3.7.4-RXN]]
+
* [[RXN-12585]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(3z)-phytochromobilin}}
+
{{#set: common-name=a cellular-retinol-binding protein}}
−
{{#set: molecular-weight=582.655}}
 
−
{{#set: inchi-key=inchikey=dkmlmzvdtgoegu-aikfxvfzsa-l}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite Cellular-Retinol-Binding-Proteins

  • common-name:
    • a cellular-retinol-binding protein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=Cellular-Retinol-Binding-Proteins&oldid=49359"