Difference between revisions of "PHENYL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-L-MYO-INOSITOL-1-P == * common-name: ** 1d-myo-inositol 3-monophosphate * molecular-weight: ** 258.121 * inchi-key: ** inapmgsxuvuwaf-p...")
(Created page with "Category:metabolite == Metabolite PHENYL == * common-name: ** acetophenone * molecular-weight: ** 120.151 * inchi-key: ** kwolfjpfchcocg-uhfffaoysa-n * smiles: ** cc(=o)c1...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-L-MYO-INOSITOL-1-P ==
+
== Metabolite PHENYL ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol 3-monophosphate
+
** acetophenone
 
* molecular-weight:
 
* molecular-weight:
** 258.121
+
** 120.151
 
* inchi-key:
 
* inchi-key:
** inapmgsxuvuwaf-ptqmnwpwsa-l
+
** kwolfjpfchcocg-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
+
** cc(=o)c1(c=cc=cc=1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
+
* [[RXN-1302]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
+
* [[RXN-1302]]
* [[RXN66-579]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol 3-monophosphate}}
+
{{#set: common-name=acetophenone}}
{{#set: molecular-weight=258.121}}
+
{{#set: molecular-weight=120.151}}
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-ptqmnwpwsa-l}}
+
{{#set: inchi-key=inchikey=kwolfjpfchcocg-uhfffaoysa-n}}

Latest revision as of 19:35, 17 March 2021

Metabolite PHENYL

  • common-name:
    • acetophenone
  • molecular-weight:
    • 120.151
  • inchi-key:
    • kwolfjpfchcocg-uhfffaoysa-n
  • smiles:
    • cc(=o)c1(c=cc=cc=1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality