Difference between revisions of "CPD-17400"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4618 == * common-name: ** cis-zeatin-7-n-glucoside * molecular-weight: ** 381.388 * inchi-key: ** htdhrclvwuexis-gihywfgssa-n * smile...")
(Created page with "Category:metabolite == Metabolite CPD-17400 == * common-name: ** a [glycerolipid]-lesquerolate == Reaction(s) known to consume the compound == == Reaction(s) known to prod...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4618 ==
+
== Metabolite CPD-17400 ==
 
* common-name:
 
* common-name:
** cis-zeatin-7-n-glucoside
+
** a [glycerolipid]-lesquerolate
* molecular-weight:
 
** 381.388
 
* inchi-key:
 
** htdhrclvwuexis-gihywfgssa-n
 
* smiles:
 
** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4733]]
+
* [[RXN-16152]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cis-zeatin-7-n-glucoside}}
+
{{#set: common-name=a [glycerolipid]-lesquerolate}}
{{#set: molecular-weight=381.388}}
 
{{#set: inchi-key=inchikey=htdhrclvwuexis-gihywfgssa-n}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite CPD-17400

  • common-name:
    • a [glycerolipid]-lesquerolate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-lesquerolate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.