Difference between revisions of "Gamma-linolenoyl-groups"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12904 == * common-name: ** (2e)-5-methylhexa-2,4-dienoyl-coa * molecular-weight: ** 871.642 * inchi-key: ** ifmyvrqehqtins-meoyllpmsa...")
(Created page with "Category:metabolite == Metabolite Gamma-linolenoyl-groups == * common-name: ** a [glycerolipid]-γ-linolenate == Reaction(s) known to consume the compound == * RXN-...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12904 ==
+
== Metabolite Gamma-linolenoyl-groups ==
 
* common-name:
 
* common-name:
** (2e)-5-methylhexa-2,4-dienoyl-coa
+
** a [glycerolipid]-γ-linolenate
* molecular-weight:
 
** 871.642
 
* inchi-key:
 
** ifmyvrqehqtins-meoyllpmsa-j
 
* smiles:
 
** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11919]]
+
* [[RXN-16043]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e)-5-methylhexa-2,4-dienoyl-coa}}
+
{{#set: common-name=a [glycerolipid]-γ-linolenate}}
{{#set: molecular-weight=871.642}}
 
{{#set: inchi-key=inchikey=ifmyvrqehqtins-meoyllpmsa-j}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite Gamma-linolenoyl-groups

  • common-name:
    • a [glycerolipid]-γ-linolenate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-γ-linolenate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.