Difference between revisions of "Gamma-linolenoyl-groups"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HYDROXY-METHYL-BUTENYL-DIP == * common-name: ** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate * molecular-weight: ** 259.069 * inchi-ke...")
(Created page with "Category:metabolite == Metabolite Gamma-linolenoyl-groups == * common-name: ** a [glycerolipid]-γ-linolenate == Reaction(s) known to consume the compound == * RXN-...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HYDROXY-METHYL-BUTENYL-DIP ==
+
== Metabolite Gamma-linolenoyl-groups ==
 
* common-name:
 
* common-name:
** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate
+
** a [glycerolipid]-γ-linolenate
* molecular-weight:
 
** 259.069
 
* inchi-key:
 
** mdsizrkjvdmqoq-gorduthdsa-k
 
* smiles:
 
** cc(co)=ccop(op([o-])(=o)[o-])(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ISPH2-RXN]]
+
* [[RXN-16043]]
* [[RXN0-884]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-882]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate}}
+
{{#set: common-name=a [glycerolipid]-γ-linolenate}}
{{#set: molecular-weight=259.069}}
 
{{#set: inchi-key=inchikey=mdsizrkjvdmqoq-gorduthdsa-k}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite Gamma-linolenoyl-groups

  • common-name:
    • a [glycerolipid]-γ-linolenate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-γ-linolenate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.