Difference between revisions of "PALMITYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12575 == * common-name: ** udp-α-d-glucose * molecular-weight: ** 564.289 * inchi-key: ** hscjrczfdfqwrp-jzmiexbbsa-l * smiles:...")
(Created page with "Category:metabolite == Metabolite PALMITYL-COA == * common-name: ** palmitoyl-coa * molecular-weight: ** 1001.915 * inchi-key: ** mnbkluuykpbkdu-bbecnahfsa-j * smiles: **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-12575 ==
+
== Metabolite PALMITYL-COA ==
 
* common-name:
 
* common-name:
−
** udp-α-d-glucose
+
** palmitoyl-coa
 
* molecular-weight:
 
* molecular-weight:
−
** 564.289
+
** 1001.915
 
* inchi-key:
 
* inchi-key:
−
** hscjrczfdfqwrp-jzmiexbbsa-l
+
** mnbkluuykpbkdu-bbecnahfsa-j
 
* smiles:
 
* smiles:
−
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
+
** cccccccccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[PALMITOYL-COA-HYDROLASE-RXN]]
−
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
+
* [[RXN-10664]]
−
* [[2.4.1.117-RXN]]
+
* [[RXN-14554]]
−
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
+
* [[RXN-15066]]
−
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [[RXN-16540]]
−
* [[GLUC1PURIDYLTRANS-RXN]]
+
* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
−
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 
−
* [[RXN-12123]]
 
−
* [[RXN-12125]]
 
−
* [[RXN-12126]]
 
−
* [[RXN-12127]]
 
−
* [[RXN-12128]]
 
−
* [[RXN-1223]]
 
−
* [[RXN-15117]]
 
−
* [[RXN-16975]]
 
−
* [[RXN-4726]]
 
−
* [[RXN-4733]]
 
−
* [[RXN-5482]]
 
−
* [[RXN-7828]]
 
−
* [[RXN-8228]]
 
−
* [[RXN1F-461]]
 
−
* [[RXN1F-462]]
 
−
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 
−
* [[TREHALOSE6PSYN-RXN]]
 
−
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
 
−
* [[UDPGLUCEPIM-RXN]]
 
−
* [[UGD-RXN]]
 
−
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [[RXN-15066]]
−
* [[GLUC1PURIDYLTRANS-RXN]]
+
* [[RXN-9623]]
−
* [[UDPGLUCEPIM-RXN]]
+
* [[RXN3O-9780]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=udp-&alpha;-d-glucose}}
+
{{#set: common-name=palmitoyl-coa}}
−
{{#set: molecular-weight=564.289}}
+
{{#set: molecular-weight=1001.915}}
−
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-jzmiexbbsa-l}}
+
{{#set: inchi-key=inchikey=mnbkluuykpbkdu-bbecnahfsa-j}}

Latest revision as of 19:35, 17 March 2021

Metabolite PALMITYL-COA

  • common-name:
    • palmitoyl-coa
  • molecular-weight:
    • 1001.915
  • inchi-key:
    • mnbkluuykpbkdu-bbecnahfsa-j
  • smiles:
    • cccccccccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=PALMITYL-COA&oldid=49410"