Difference between revisions of "PALMITYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17401 == * common-name: ** 3-oxo-auricoloyl-coa * molecular-weight: ** 1083.973 * inchi-key: ** fgcwebktqlbclr-jrszcninsa-j * smiles:...")
 
(Created page with "Category:metabolite == Metabolite PALMITYL-COA == * common-name: ** palmitoyl-coa * molecular-weight: ** 1001.915 * inchi-key: ** mnbkluuykpbkdu-bbecnahfsa-j * smiles: **...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17401 ==
+
== Metabolite PALMITYL-COA ==
 
* common-name:
 
* common-name:
** 3-oxo-auricoloyl-coa
+
** palmitoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 1083.973
+
** 1001.915
 
* inchi-key:
 
* inchi-key:
** fgcwebktqlbclr-jrszcninsa-j
+
** mnbkluuykpbkdu-bbecnahfsa-j
 
* smiles:
 
* smiles:
** ccc=cccc(o)cc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cccccccccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16154]]
+
* [[PALMITOYL-COA-HYDROLASE-RXN]]
 +
* [[RXN-10664]]
 +
* [[RXN-14554]]
 +
* [[RXN-15066]]
 +
* [[RXN-16540]]
 +
* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15066]]
 +
* [[RXN-9623]]
 +
* [[RXN3O-9780]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-auricoloyl-coa}}
+
{{#set: common-name=palmitoyl-coa}}
{{#set: molecular-weight=1083.973}}
+
{{#set: molecular-weight=1001.915}}
{{#set: inchi-key=inchikey=fgcwebktqlbclr-jrszcninsa-j}}
+
{{#set: inchi-key=inchikey=mnbkluuykpbkdu-bbecnahfsa-j}}

Latest revision as of 19:35, 17 March 2021

Metabolite PALMITYL-COA

  • common-name:
    • palmitoyl-coa
  • molecular-weight:
    • 1001.915
  • inchi-key:
    • mnbkluuykpbkdu-bbecnahfsa-j
  • smiles:
    • cccccccccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality