Difference between revisions of "PROPIONYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INOSITOL-1-4-BISPHOSPHATE == * common-name: ** d-myo-inositol (1,4)-bisphosphate * molecular-weight: ** 336.085 * inchi-key: ** pelzspzcx...")
(Created page with "Category:metabolite == Metabolite PROPIONYL-COA == * common-name: ** propanoyl-coa * molecular-weight: ** 819.566 * inchi-key: ** qaqrevbbadehpa-iexphmlfsa-j * smiles: **...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite INOSITOL-1-4-BISPHOSPHATE ==
+
== Metabolite PROPIONYL-COA ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,4)-bisphosphate
+
** propanoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 336.085
+
** 819.566
 
* inchi-key:
 
* inchi-key:
** pelzspzcxgtumr-rtphhqfdsa-j
+
** qaqrevbbadehpa-iexphmlfsa-j
 
* smiles:
 
* smiles:
** c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([o-])([o-])=o)1)
+
** ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.3.57-RXN]]
+
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.3.56-RXN]]
+
* [[1.2.1.27-RXN]]
* [[RXN-13334]]
+
* [[2.3.1.176-RXN]]
 +
* [[KETOBUTFORMLY-RXN]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
* [[RXN-11213]]
 +
* [[RXN-12561]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,4)-bisphosphate}}
+
{{#set: common-name=propanoyl-coa}}
{{#set: molecular-weight=336.085}}
+
{{#set: molecular-weight=819.566}}
{{#set: inchi-key=inchikey=pelzspzcxgtumr-rtphhqfdsa-j}}
+
{{#set: inchi-key=inchikey=qaqrevbbadehpa-iexphmlfsa-j}}

Latest revision as of 19:35, 17 March 2021

Metabolite PROPIONYL-COA

  • common-name:
    • propanoyl-coa
  • molecular-weight:
    • 819.566
  • inchi-key:
    • qaqrevbbadehpa-iexphmlfsa-j
  • smiles:
    • ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality