Difference between revisions of "CARBON-DIOXIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OH-HEXANOYL-COA == * common-name: ** (s)-3-hydroxyhexanoyl-coa * molecular-weight: ** 877.646 * inchi-key: ** vaahkrmgofiorx-dwufxmdisa-j...")
(Created page with "Category:metabolite == Metabolite CARBON-DIOXIDE == * common-name: ** co2 * molecular-weight: ** 44.01 * inchi-key: ** curltugmzlyldi-uhfffaoysa-n * smiles: ** c(=o)=o ==...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OH-HEXANOYL-COA ==
+
== Metabolite CARBON-DIOXIDE ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxyhexanoyl-coa
+
** co2
 
* molecular-weight:
 
* molecular-weight:
** 877.646
+
** 44.01
 
* inchi-key:
 
* inchi-key:
** vaahkrmgofiorx-dwufxmdisa-j
+
** curltugmzlyldi-uhfffaoysa-n
 
* smiles:
 
* smiles:
** cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
+
** c(=o)=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12567]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.2.1.18-RXN]]
 +
* [[1.2.1.2-RXN]]
 +
* [[1.2.4.4-RXN]]
 +
* [[2KETO-3METHYLVALERATE-RXN]]
 +
* [[AIRCARBOXY-RXN]]
 +
* [[ARGDECARBOX-RXN]]
 +
* [[CARBODEHYDRAT-RXN]]
 +
* [[DETHIOBIOTIN-SYN-RXN]]
 +
* [[ExchangeSeed-CARBON-DIOXIDE]]
 +
* [[GCVMULTI-RXN]]
 +
* [[GCVMULTI-RXN-GLY/THF/NAD//METHYLENE-THF/AMMONIUM/CARBON-DIOXIDE/NADH.56.]]
 +
* [[GCVP-RXN]]
 +
* [[ISOCITDEH-RXN]]
 +
* [[METHYLVALERATE-RXN]]
 +
* [[PREPHENATEDEHYDRAT-RXN]]
 +
* [[RXN-17679]]
 +
* [[RXN-8349_PLANTCYC]]
 +
* [[RXN-8642]]
 +
* [[RXN0-5224]]
 +
* [[RXN1G-460]]
 +
* [[TransportSeed-CARBON-DIOXIDE]]
 +
* [[UREASE-RXN]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12570]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.1.1.39-RXN]]
 +
* [[1.14.11.2-RXN]]
 +
* [[1.2.1.18-RXN]]
 +
* [[1.2.1.2-RXN]]
 +
* [[1.2.1.25-RXN]]
 +
* [[1.2.4.4-RXN]]
 +
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
 +
* [[2.3.1.179-RXN]]
 +
* [[2.3.1.41-RXN]]
 +
* [[2.5.1.64-RXN]]
 +
* [[2KETO-3METHYLVALERATE-RXN]]
 +
* [[2KETO-4METHYL-PENTANOATE-DEHYDROG-RXN]]
 +
* [[2OXOGLUTDECARB-RXN]]
 +
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
 +
* [[3-OXOACYL-ACP-SYNTH-RXN]]
 +
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
 +
* [[6PGLUCONDEHYDROG-RXN]]
 +
* [[7KAPSYN-RXN]]
 +
* [[ACETOLACTSYN-RXN]]
 +
* [[ACETOOHBUTSYN-RXN]]
 +
* [[AIRCARBOXY-RXN]]
 +
* [[ARGDECARBOX-RXN]]
 +
* [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]]
 +
* [[BETA-UREIDOPROPIONASE-RXN]]
 +
* [[CARBODEHYDRAT-RXN]]
 +
* [[CARBOXYCYCLOHEXADIENYL-DEHYDRATASE-RXN]]
 +
* [[DIAMINOPIMDECARB-RXN]]
 +
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
 +
* [[DXS-RXN]]
 +
* [[ExchangeSeed-CARBON-DIOXIDE]]
 +
* [[FATTY-ACID-SYNTHASE-RXN]]
 +
* [[GCVMULTI-RXN]]
 +
* [[GCVMULTI-RXN-GLY/THF/NAD//METHYLENE-THF/AMMONIUM/CARBON-DIOXIDE/NADH.56.]]
 +
* [[GCVP-RXN]]
 +
* [[HEMN-RXN]]
 +
* [[IGPSYN-RXN]]
 +
* [[ISOCITDEH-RXN]]
 +
* [[KETOISOCAPROATE-RXN]]
 +
* [[MALIC-NADP-RXN]]
 +
* [[MALONYL-COA-DECARBOXYLASE-RXN]]
 +
* [[METHYLVALERATE-RXN]]
 +
* [[N-CARBAMOYLPUTRESCINE-AMIDASE-RXN]]
 +
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
 +
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
 +
* [[ORNDECARBOX-RXN]]
 +
* [[OROTPDECARB-RXN]]
 +
* [[OXALATE-OXIDASE-RXN]]
 +
* [[OXALODECARB-RXN]]
 +
* [[P-PANTOCYSDECARB-RXN]]
 +
* [[PEPCARBOXYKIN-RXN]]
 +
* [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]]
 +
* [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[PREPHENATEDEHYDRAT-RXN]]
 +
* [[PREPHENATEDEHYDROG-RXN]]
 +
* [[PYRUVDEH-RXN]]
 +
* [[QUINOPRIBOTRANS-RXN]]
 +
* [[RXN-10059]]
 +
* [[RXN-10642]]
 +
* [[RXN-10654]]
 +
* [[RXN-10658]]
 +
* [[RXN-10734]]
 +
* [[RXN-10815]]
 +
* [[RXN-11210]]
 +
* [[RXN-113]]
 +
* [[RXN-11403]]
 +
* [[RXN-11474]]
 +
* [[RXN-11479]]
 +
* [[RXN-115]]
 +
* [[RXN-12539]]
 +
* [[RXN-12583]]
 +
* [[RXN-12610]]
 +
* [[RXN-12611]]
 +
* [[RXN-13158]]
 +
* [[RXN-13186]]
 +
* [[RXN-13295]]
 +
* [[RXN-13431]]
 +
* [[RXN-13442]]
 +
* [[RXN-14972]]
 +
* [[RXN-14981]]
 +
* [[RXN-14986]]
 +
* [[RXN-16016]]
 +
* [[RXN-16082]]
 +
* [[RXN-16094]]
 +
* [[RXN-16615]]
 +
* [[RXN-16621]]
 +
* [[RXN-16625]]
 +
* [[RXN-16629]]
 +
* [[RXN-171]]
 +
* [[RXN-17679]]
 +
* [[RXN-21830]]
 +
* [[RXN-2541]]
 +
* [[RXN-2902]]
 +
* [[RXN-3142]]
 +
* [[RXN-3341]]
 +
* [[RXN-527]]
 +
* [[RXN-5641]]
 +
* [[RXN-602]]
 +
* [[RXN-6081]]
 +
* [[RXN-6201]]
 +
* [[RXN-6550]]
 +
* [[RXN-7645]]
 +
* [[RXN-7648]]
 +
* [[RXN-7697]]
 +
* [[RXN-7745]]
 +
* [[RXN-7775]]
 +
* [[RXN-7800]]
 +
* [[RXN-7922]]
 +
* [[RXN-8243]]
 +
* [[RXN-8349_PLANTCYC]]
 +
* [[RXN-8450]]
 +
* [[RXN-8642]]
 +
* [[RXN-8660]]
 +
* [[RXN-8661]]
 +
* [[RXN-8766]]
 +
* [[RXN-9516]]
 +
* [[RXN-9523]]
 +
* [[RXN-9527]]
 +
* [[RXN-9531]]
 +
* [[RXN-9535]]
 +
* [[RXN-9539]]
 +
* [[RXN-9632]]
 +
* [[RXN-9648]]
 +
* [[RXN-9650]]
 +
* [[RXN-9651]]
 +
* [[RXN-9652]]
 +
* [[RXN-9653]]
 +
* [[RXN-9654]]
 +
* [[RXN-9952]]
 +
* [[RXN-9958]]
 +
* [[RXN0-1134]]
 +
* [[RXN0-1461]]
 +
* [[RXN0-2141]]
 +
* [[RXN0-5222]]
 +
* [[RXN0-5224]]
 +
* [[RXN1F-162]]
 +
* [[RXN1F-163]]
 +
* [[RXN1F-165]]
 +
* [[RXN1F-167]]
 +
* [[RXN1F-168]]
 +
* [[RXN1F-93]]
 +
* [[RXN1G-368]]
 +
* [[RXN1G-445]]
 +
* [[RXN1G-460]]
 +
* [[RXN1G-499]]
 +
* [[RXN3DJ-170]]
 +
* [[RXN3O-1803]]
 +
* [[RXN490-3641]]
 +
* [[RXN66-221]]
 +
* [[RXN66-318]]
 +
* [[SAMDECARB-RXN]]
 +
* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
 +
* [[TransportSeed-CARBON-DIOXIDE]]
 +
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
 +
* [[UREASE-RXN]]
 +
* [[UROGENDECARBOX-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxyhexanoyl-coa}}
+
{{#set: common-name=co2}}
{{#set: molecular-weight=877.646}}
+
{{#set: molecular-weight=44.01}}
{{#set: inchi-key=inchikey=vaahkrmgofiorx-dwufxmdisa-j}}
+
{{#set: inchi-key=inchikey=curltugmzlyldi-uhfffaoysa-n}}

Latest revision as of 19:35, 17 March 2021

Metabolite CARBON-DIOXIDE

  • common-name:
    • co2
  • molecular-weight:
    • 44.01
  • inchi-key:
    • curltugmzlyldi-uhfffaoysa-n
  • smiles:
    • c(=o)=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality