Difference between revisions of "CPD-13118"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10495 == * common-name: ** ferroleghemoglobin * molecular-weight: ** 612.553 * inchi-key: ** muzoolfynbceiq-pvpkhrjzsa-n * smiles: **...") |
(Created page with "Category:metabolite == Metabolite CPD-13118 == * common-name: ** gdp-β-l-fucose * molecular-weight: ** 587.33 * inchi-key: ** lqebexmhblqmdb-jgqubwhwsa-l * smiles: **...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-13118 == |
* common-name: | * common-name: | ||
| − | ** | + | ** gdp-β-l-fucose |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 587.33 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lqebexmhblqmdb-jgqubwhwsa-l |
* smiles: | * smiles: | ||
| − | ** | + | ** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.1.1.271-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=gdp-β-l-fucose}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=587.33}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lqebexmhblqmdb-jgqubwhwsa-l}} |
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite CPD-13118
- common-name:
- gdp-β-l-fucose
- molecular-weight:
- 587.33
- inchi-key:
- lqebexmhblqmdb-jgqubwhwsa-l
- smiles:
- cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
