Difference between revisions of "INOSITOL-1-3-4-TRIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14425 == * common-name: ** (2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa * molecular-weight: ** 1073.981 * inchi-key: ** hgvxutaezaltig...")
(Created page with "Category:metabolite == Metabolite INOSITOL-1-3-4-TRIPHOSPHATE == * common-name: ** d-myo-inositol (1,3,4)-trisphosphate * molecular-weight: ** 414.049 * inchi-key: ** mmwc...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14425 ==
+
== Metabolite INOSITOL-1-3-4-TRIPHOSPHATE ==
 
* common-name:
 
* common-name:
** (2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa
+
** d-myo-inositol (1,3,4)-trisphosphate
 
* molecular-weight:
 
* molecular-weight:
** 1073.981
+
** 414.049
 
* inchi-key:
 
* inchi-key:
** hgvxutaezaltig-hkhrklhhsa-j
+
** mmwciqzxvozegg-mlqgymepsa-h
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13445]]
+
* [[2.7.1.133-RXN]]
 +
* [[2.7.1.139-RXN]]
 +
* [[RXN-10939]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13444]]
+
* [[RXN-8730]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa}}
+
{{#set: common-name=d-myo-inositol (1,3,4)-trisphosphate}}
{{#set: molecular-weight=1073.981}}
+
{{#set: molecular-weight=414.049}}
{{#set: inchi-key=inchikey=hgvxutaezaltig-hkhrklhhsa-j}}
+
{{#set: inchi-key=inchikey=mmwciqzxvozegg-mlqgymepsa-h}}

Latest revision as of 19:35, 17 March 2021

Metabolite INOSITOL-1-3-4-TRIPHOSPHATE

  • common-name:
    • d-myo-inositol (1,3,4)-trisphosphate
  • molecular-weight:
    • 414.049
  • inchi-key:
    • mmwciqzxvozegg-mlqgymepsa-h
  • smiles:
    • c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality