Difference between revisions of "GTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SUC-COA == * common-name: ** succinyl-coa * molecular-weight: ** 862.568 * inchi-key: ** vnoyujkhfwywir-itiydsspsa-i * smiles: ** cc(c)(c...")
(Created page with "Category:metabolite == Metabolite GTP == * common-name: ** gtp * molecular-weight: ** 519.151 * inchi-key: ** xkmlyualxhknft-uuokfmhzsa-j * smiles: ** c(op([o-])(=o)op(=o)...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SUC-COA ==
+
== Metabolite GTP ==
 
* common-name:
 
* common-name:
** succinyl-coa
+
** gtp
 
* molecular-weight:
 
* molecular-weight:
** 862.568
+
** 519.151
 
* inchi-key:
 
* inchi-key:
** vnoyujkhfwywir-itiydsspsa-i
+
** xkmlyualxhknft-uuokfmhzsa-j
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HOMSUCTRAN-RXN]]
+
* [[2.7.7.13-RXN]]
* [[METHYLMALONYL-COA-MUT-RXN]]
+
* [[2.7.7.30-RXN]]
* [[RXN0-1147]]
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
* [[SUCCCOASYN-RXN]]
+
* [[ExchangeSeed-GTP]]
 +
* [[GTP-CYCLOHYDRO-I-RXN]]
 +
* [[GTP-CYCLOHYDRO-II-RXN]]
 +
* [[GTPPYPHOSKIN-RXN]]
 +
* [[GUANYLCYC-RXN]]
 +
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
 +
* [[RXN-11409]]
 +
* [[RXN-14074]]
 +
* [[RXN-14140]]
 +
* [[RXN-8340]]
 +
* [[RXN-8988]]
 +
* [[RXN0-5359]]
 +
* [[RXN0-5462]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[TransportSeed-GTP]]
 +
* [[URKI-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[METHYLMALONYL-COA-MUT-RXN]]
+
* [[ExchangeSeed-GTP]]
* [[RXN0-1147]]
+
* [[GDPKIN-RXN]]
* [[SUCCCOASYN-RXN]]
+
* [[RXN-14117]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[TransportSeed-GTP]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=succinyl-coa}}
+
{{#set: common-name=gtp}}
{{#set: molecular-weight=862.568}}
+
{{#set: molecular-weight=519.151}}
{{#set: inchi-key=inchikey=vnoyujkhfwywir-itiydsspsa-i}}
+
{{#set: inchi-key=inchikey=xkmlyualxhknft-uuokfmhzsa-j}}

Latest revision as of 19:35, 17 March 2021

Metabolite GTP

  • common-name:
    • gtp
  • molecular-weight:
    • 519.151
  • inchi-key:
    • xkmlyualxhknft-uuokfmhzsa-j
  • smiles:
    • c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality