Difference between revisions of "Glycogens"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12481 == * common-name: ** 7-methylurate * molecular-weight: ** 182.138 * inchi-key: ** yhnnpkufpwltop-uhfffaoysa-n * smiles: ** cn1(...")
(Created page with "Category:metabolite == Metabolite Glycogens == * common-name: ** a glycogen == Reaction(s) known to consume the compound == * GLYCOPHOSPHORYL-RXN * GLYMALTOPHOSPHORY...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12481 ==
+
== Metabolite Glycogens ==
 
* common-name:
 
* common-name:
** 7-methylurate
+
** a glycogen
* molecular-weight:
 
** 182.138
 
* inchi-key:
 
** yhnnpkufpwltop-uhfffaoysa-n
 
* smiles:
 
** cn1(c(=o)nc2(=c1c(=o)nc(=o)n2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GLYCOPHOSPHORYL-RXN]]
 +
* [[GLYMALTOPHOSPHORYL-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11521]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7-methylurate}}
+
{{#set: common-name=a glycogen}}
{{#set: molecular-weight=182.138}}
 
{{#set: inchi-key=inchikey=yhnnpkufpwltop-uhfffaoysa-n}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite Glycogens

  • common-name:
    • a glycogen

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality