Difference between revisions of "CPD-166"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11939 == * common-name: ** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate * molecular-weight: ** 805.885 * inchi-...")
 
(Created page with "Category:metabolite == Metabolite CPD-166 == * common-name: ** a dolichyl β-d-glucosyl phosphate == Reaction(s) known to consume the compound == * RXN-16593 * R...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11939 ==
+
== Metabolite CPD-166 ==
 
* common-name:
 
* common-name:
** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate
+
** a dolichyl β-d-glucosyl phosphate
* molecular-weight:
 
** 805.885
 
* inchi-key:
 
** hhqooerqsfjgep-zsiqdkgesa-a
 
* smiles:
 
** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op(=o)([o-])op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op([o-])(=o)[o-])c(op([o-])([o-])=o)1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16593]]
 +
* [[RXN-5470]]
 +
* [[RXN-5471]]
 +
* [[RXN-5472]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10973]]
+
* [[2.4.1.117-RXN]]
* [[RXN-10979]]
+
* [[RXN-16593]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate}}
+
{{#set: common-name=a dolichyl β-d-glucosyl phosphate}}
{{#set: molecular-weight=805.885}}
 
{{#set: inchi-key=inchikey=hhqooerqsfjgep-zsiqdkgesa-a}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite CPD-166

  • common-name:
    • a dolichyl β-d-glucosyl phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality