Difference between revisions of "METHYL-BETA-D-GALACTOSIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11939 == * common-name: ** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate * molecular-weight: ** 805.885 * inchi-...")
(Created page with "Category:metabolite == Metabolite METHYL-BETA-D-GALACTOSIDE == * common-name: ** methyl-β-d-galactoside * molecular-weight: ** 194.184 * inchi-key: ** hovagtypodgvjg-...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11939 ==
+
== Metabolite METHYL-BETA-D-GALACTOSIDE ==
 
* common-name:
 
* common-name:
** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate
+
** methyl-β-d-galactoside
 
* molecular-weight:
 
* molecular-weight:
** 805.885
+
** 194.184
 
* inchi-key:
 
* inchi-key:
** hhqooerqsfjgep-zsiqdkgesa-a
+
** hovagtypodgvjg-voqcikjusa-n
 
* smiles:
 
* smiles:
** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op(=o)([o-])op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op([o-])(=o)[o-])c(op([o-])([o-])=o)1)
+
** coc1(oc(co)c(o)c(o)c(o)1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10973]]
+
* [[12-ALPHA-L-FUCOSIDASE-RXN]]
* [[RXN-10979]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate}}
+
{{#set: common-name=methyl-β-d-galactoside}}
{{#set: molecular-weight=805.885}}
+
{{#set: molecular-weight=194.184}}
{{#set: inchi-key=inchikey=hhqooerqsfjgep-zsiqdkgesa-a}}
+
{{#set: inchi-key=inchikey=hovagtypodgvjg-voqcikjusa-n}}

Latest revision as of 19:35, 17 March 2021

Metabolite METHYL-BETA-D-GALACTOSIDE

  • common-name:
    • methyl-β-d-galactoside
  • molecular-weight:
    • 194.184
  • inchi-key:
    • hovagtypodgvjg-voqcikjusa-n
  • smiles:
    • coc1(oc(co)c(o)c(o)c(o)1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality