Difference between revisions of "METHYL-BETA-D-GALACTOSIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DMPBQ == * common-name: ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol * molecular-weight: ** 416.686 * inchi-key: ** sufzkubnovdjrr-wgeodtkdsa...") |
(Created page with "Category:metabolite == Metabolite METHYL-BETA-D-GALACTOSIDE == * common-name: ** methyl-β-d-galactoside * molecular-weight: ** 194.184 * inchi-key: ** hovagtypodgvjg-...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite METHYL-BETA-D-GALACTOSIDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** methyl-β-d-galactoside |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 194.184 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hovagtypodgvjg-voqcikjusa-n |
* smiles: | * smiles: | ||
| − | ** | + | ** coc1(oc(co)c(o)c(o)c(o)1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[12-ALPHA-L-FUCOSIDASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=methyl-β-d-galactoside}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=194.184}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hovagtypodgvjg-voqcikjusa-n}} |
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite METHYL-BETA-D-GALACTOSIDE
- common-name:
- methyl-β-d-galactoside
- molecular-weight:
- 194.184
- inchi-key:
- hovagtypodgvjg-voqcikjusa-n
- smiles:
- coc1(oc(co)c(o)c(o)c(o)1)
