Difference between revisions of "CPD-452"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-641 == * common-name: ** (r)-mevalonate diphosphate * molecular-weight: ** 304.087 * inchi-key: ** sigqqubjqxsamw-zcfiwibfsa-j * smil...")
(Created page with "Category:metabolite == Metabolite CPD-452 == * common-name: ** a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol == Reaction(s) known to consume the com...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-641 ==
+
== Metabolite CPD-452 ==
 
* common-name:
 
* common-name:
** (r)-mevalonate diphosphate
+
** a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol
* molecular-weight:
 
** 304.087
 
* inchi-key:
 
** sigqqubjqxsamw-zcfiwibfsa-j
 
* smiles:
 
** cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
+
* [[2.4.1.198-RXN]]
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
+
* [[3.1.1.69-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
+
* [[2.4.1.198-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-mevalonate diphosphate}}
+
{{#set: common-name=a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol}}
{{#set: molecular-weight=304.087}}
 
{{#set: inchi-key=inchikey=sigqqubjqxsamw-zcfiwibfsa-j}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite CPD-452

  • common-name:
    • a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality