Difference between revisions of "FARNESYL-PP"

Latest revision as of 19:35, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL ==
+== Metabolite FARNESYL-PP ==
 * common-name:
-** 5&alpha;-cholesta-7,24-dien-3&beta;-ol
+** (2e,6e)-farnesyl diphosphate
 * molecular-weight:
-** 384.644
+** 379.306
 * inchi-key:
-** pkeppdggtszlbl-skcnuyalsa-n
+** vwfjdquyciwhtn-yfvjmotdsa-k
 * smiles:
-** cc(c)=cccc(c)[ch]1(cc[ch]3(c(c)1cc[ch]2(c4(c)([ch](cc=c23)cc(o)cc4))))
+** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
 == Reaction(s) known to consume the compound ==
+* [[2.5.1.58-RXN]]
+* [[FARNESYLTRANSTRANSFERASE-RXN]]
+* [[HEMEOSYN-RXN]]
+* [[RXN-12263]]
+* [[RXN-13162]]
+* [[RXN-17573]]
+* [[RXN-8999]]
+* [[RXN0-5180]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-21837]]
+* [[2.5.1.58-RXN]]
-* [[RXN66-320]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=5&alpha;-cholesta-7,24-dien-3&beta;-ol}}
+{{#set: common-name=(2e,6e)-farnesyl diphosphate}}
-{{#set: molecular-weight=384.644}}
+{{#set: molecular-weight=379.306}}
-{{#set: inchi-key=inchikey=pkeppdggtszlbl-skcnuyalsa-n}}
+{{#set: inchi-key=inchikey=vwfjdquyciwhtn-yfvjmotdsa-k}}