Difference between revisions of "FARNESYL-PP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL == * common-name: ** 5α-cholesta-7,24-dien-3β-ol * molecular-weight: ** 384.644 * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite FARNESYL-PP == * common-name: ** (2e,6e)-farnesyl diphosphate * molecular-weight: ** 379.306 * inchi-key: ** vwfjdquyciwhtn-yfvjmotdsa-k...") |
||
(3 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite FARNESYL-PP == |
* common-name: | * common-name: | ||
− | ** | + | ** (2e,6e)-farnesyl diphosphate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 379.306 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vwfjdquyciwhtn-yfvjmotdsa-k |
* smiles: | * smiles: | ||
− | ** cc( | + | ** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2.5.1.58-RXN]] | ||
+ | * [[FARNESYLTRANSTRANSFERASE-RXN]] | ||
+ | * [[HEMEOSYN-RXN]] | ||
+ | * [[RXN-12263]] | ||
+ | * [[RXN-13162]] | ||
+ | * [[RXN-17573]] | ||
+ | * [[RXN-8999]] | ||
+ | * [[RXN0-5180]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[2.5.1.58-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2e,6e)-farnesyl diphosphate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=379.306}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vwfjdquyciwhtn-yfvjmotdsa-k}} |
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite FARNESYL-PP
- common-name:
- (2e,6e)-farnesyl diphosphate
- molecular-weight:
- 379.306
- inchi-key:
- vwfjdquyciwhtn-yfvjmotdsa-k
- smiles:
- cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
Reaction(s) known to consume the compound
- 2.5.1.58-RXN
- FARNESYLTRANSTRANSFERASE-RXN
- HEMEOSYN-RXN
- RXN-12263
- RXN-13162
- RXN-17573
- RXN-8999
- RXN0-5180