Difference between revisions of "5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15688 == * common-name: ** (3z,5e)-dodeca-3,5-dienoyl-coa * molecular-weight: ** 941.776 * inchi-key: ** arquzfjqpywssl-nbluimthsa-j...")
(Created page with "Category:metabolite == Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE == * common-name: ** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide * molecular-weight: ** 312.172...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-15688 ==
+
== Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE ==
 
* common-name:
 
* common-name:
−
** (3z,5e)-dodeca-3,5-dienoyl-coa
+
** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide
 
* molecular-weight:
 
* molecular-weight:
−
** 941.776
+
** 312.172
 
* inchi-key:
 
* inchi-key:
−
** arquzfjqpywssl-nbluimthsa-j
+
** vdxlundmvkskho-xvfcmesisa-l
 
* smiles:
 
* smiles:
−
** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[FGAMSYN-RXN]]
 +
* [[GART-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-14799]]
+
* [[GART-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(3z,5e)-dodeca-3,5-dienoyl-coa}}
+
{{#set: common-name=n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide}}
−
{{#set: molecular-weight=941.776}}
+
{{#set: molecular-weight=312.172}}
−
{{#set: inchi-key=inchikey=arquzfjqpywssl-nbluimthsa-j}}
+
{{#set: inchi-key=inchikey=vdxlundmvkskho-xvfcmesisa-l}}

Latest revision as of 19:35, 17 March 2021

Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE

  • common-name:
    • n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide
  • molecular-weight:
    • 312.172
  • inchi-key:
    • vdxlundmvkskho-xvfcmesisa-l
  • smiles:
    • c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE&oldid=49624"