Difference between revisions of "5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Oxo-glutarate-dehydrogenase-DH-lipoyl == * common-name: ** a [2-oxoglutarate dehydrogenase e2 protein] n6-dihydrolipoyl-l-lysine == React...")
 
(Created page with "Category:metabolite == Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE == * common-name: ** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide * molecular-weight: ** 312.172...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Oxo-glutarate-dehydrogenase-DH-lipoyl ==
+
== Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE ==
 
* common-name:
 
* common-name:
** a [2-oxoglutarate dehydrogenase e2 protein] n6-dihydrolipoyl-l-lysine
+
** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide
 +
* molecular-weight:
 +
** 312.172
 +
* inchi-key:
 +
** vdxlundmvkskho-xvfcmesisa-l
 +
* smiles:
 +
** c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7716]]
+
* [[FGAMSYN-RXN]]
* [[RXN0-1147]]
+
* [[GART-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7716]]
+
* [[GART-RXN]]
* [[RXN0-1147]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [2-oxoglutarate dehydrogenase e2 protein] n6-dihydrolipoyl-l-lysine}}
+
{{#set: common-name=n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide}}
 +
{{#set: molecular-weight=312.172}}
 +
{{#set: inchi-key=inchikey=vdxlundmvkskho-xvfcmesisa-l}}

Latest revision as of 19:35, 17 March 2021

Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE

  • common-name:
    • n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide
  • molecular-weight:
    • 312.172
  • inchi-key:
    • vdxlundmvkskho-xvfcmesisa-l
  • smiles:
    • c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality