Difference between revisions of "Cis-cis-D19-37-C56-2-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7417 == * common-name: ** cis-coumarinic acid-β-d-glucoside * molecular-weight: ** 325.294 * inchi-key: ** gvriyimnjgulcz-qlfwqt...")
(Created page with "Category:metabolite == Metabolite cis-cis-D19-37-C56-2-ACPs == * common-name: ** a cis,cis-delta19-37-c56:2-[acp] == Reaction(s) known to consume the compound == * RXN1G...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7417 ==
+
== Metabolite cis-cis-D19-37-C56-2-ACPs ==
 
* common-name:
 
* common-name:
** cis-coumarinic acid-β-d-glucoside
+
** a cis,cis-delta19-37-c56:2-[acp]
* molecular-weight:
 
** 325.294
 
* inchi-key:
 
** gvriyimnjgulcz-qlfwqtqqsa-m
 
* smiles:
 
** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8036]]
+
* [[RXN1G-2527]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cis-coumarinic acid-β-d-glucoside}}
+
{{#set: common-name=a cis,cis-delta19-37-c56:2-[acp]}}
{{#set: molecular-weight=325.294}}
 
{{#set: inchi-key=inchikey=gvriyimnjgulcz-qlfwqtqqsa-m}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite cis-cis-D19-37-C56-2-ACPs

  • common-name:
    • a cis,cis-delta19-37-c56:2-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cis,cis-delta19-37-c56:2-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.