Difference between revisions of "16S-rRNA-guanine-1207"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE == * common-name: ** luteolin 7-o-β-d-diglucuronide * molecular-weight: ** 636.476 * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite 16S-rRNA-guanine-1207 == * common-name: ** a guanine1207 in 16s rrna == Reaction(s) known to consume the compound == * RXN-11576 == R...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE ==
+
== Metabolite 16S-rRNA-guanine-1207 ==
 
* common-name:
 
* common-name:
−
** luteolin 7-o-β-d-diglucuronide
+
** a guanine1207 in 16s rrna
−
* molecular-weight:
 
−
** 636.476
 
−
* inchi-key:
 
−
** pbbvwjqpazyqdb-dbfweqbmsa-l
 
−
* smiles:
 
−
** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-15288]]
+
* [[RXN-11576]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=luteolin 7-o-β-d-diglucuronide}}
+
{{#set: common-name=a guanine1207 in 16s rrna}}
−
{{#set: molecular-weight=636.476}}
 
−
{{#set: inchi-key=inchikey=pbbvwjqpazyqdb-dbfweqbmsa-l}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite 16S-rRNA-guanine-1207

  • common-name:
    • a guanine1207 in 16s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=16S-rRNA-guanine-1207&oldid=49698"