Difference between revisions of "CPD1G-124"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-DOPACHROME == * common-name: ** l-dopachrome * molecular-weight: ** 192.151 * inchi-key: ** vjncicvkuhkiiv-lurjtmiesa-m * smiles: ** c(...")
(Created page with "Category:metabolite == Metabolite CPD1G-124 == * common-name: ** a c52-α-meroacyl-adenylate == Reaction(s) known to consume the compound == == Reaction(s) known to p...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-DOPACHROME ==
+
== Metabolite CPD1G-124 ==
 
* common-name:
 
* common-name:
** l-dopachrome
+
** a c52-α-meroacyl-adenylate
* molecular-weight:
 
** 192.151
 
* inchi-key:
 
** vjncicvkuhkiiv-lurjtmiesa-m
 
* smiles:
 
** c([o-])(=o)c1(nc2(c(c1)=cc(=o)c(=o)c=2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11403]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11369]]
+
* [[RXN1G-3993]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-dopachrome}}
+
{{#set: common-name=a c52-α-meroacyl-adenylate}}
{{#set: molecular-weight=192.151}}
 
{{#set: inchi-key=inchikey=vjncicvkuhkiiv-lurjtmiesa-m}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite CPD1G-124

  • common-name:
    • a c52-α-meroacyl-adenylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality