Difference between revisions of "CPD1G-124"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-P-BETA-D-RIBOSYL-AMINE == * common-name: ** 5-phospho-β-d-ribosylamine * molecular-weight: ** 228.118 * inchi-key: ** skcbpevygoqg...")
 
(Created page with "Category:metabolite == Metabolite CPD1G-124 == * common-name: ** a c52-α-meroacyl-adenylate == Reaction(s) known to consume the compound == == Reaction(s) known to p...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-P-BETA-D-RIBOSYL-AMINE ==
+
== Metabolite CPD1G-124 ==
 
* common-name:
 
* common-name:
** 5-phospho-β-d-ribosylamine
+
** a c52-α-meroacyl-adenylate
* molecular-weight:
 
** 228.118
 
* inchi-key:
 
** skcbpevygoqgjn-txicztdvsa-m
 
* smiles:
 
** c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLYRIBONUCSYN-RXN]]
 
* [[PRPPAMIDOTRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PRPPAMIDOTRANS-RXN]]
+
* [[RXN1G-3993]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-phospho-β-d-ribosylamine}}
+
{{#set: common-name=a c52-α-meroacyl-adenylate}}
{{#set: molecular-weight=228.118}}
 
{{#set: inchi-key=inchikey=skcbpevygoqgjn-txicztdvsa-m}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite CPD1G-124

  • common-name:
    • a c52-α-meroacyl-adenylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality