Difference between revisions of "Nucleoside-Monophosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALLANTOATE == * common-name: ** allantoate * molecular-weight: ** 175.124 * inchi-key: ** nucljnswzchrkl-uhfffaoysa-m * smiles: ** c(c(=o...")
(Created page with "Category:metabolite == Metabolite Nucleoside-Monophosphates == * common-name: ** a nucleoside 5'-monophosphate == Reaction(s) known to consume the compound == * NUCLEOSI...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ALLANTOATE ==
+
== Metabolite Nucleoside-Monophosphates ==
 
* common-name:
 
* common-name:
** allantoate
+
** a nucleoside 5'-monophosphate
* molecular-weight:
 
** 175.124
 
* inchi-key:
 
** nucljnswzchrkl-uhfffaoysa-m
 
* smiles:
 
** c(c(=o)[o-])(nc(=o)n)nc(=o)n
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ALLANTOICASE-RXN]]
+
* [[NUCLEOSIDE-PHOSPHATE-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ALLANTOINASE-RXN]]
+
* [[3.1.26.4-RXN]]
 +
* [[3.1.4.1-RXN]]
 +
* [[3.1.4.17-RXN]]
 +
* [[3.6.1.19-RXN]]
 +
* [[NUCLEOSIDE-DIPHOSPHATASE-RXN]]
 +
* [[NUCLEOTIDE-PYROPHOSPHATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=allantoate}}
+
{{#set: common-name=a nucleoside 5'-monophosphate}}
{{#set: molecular-weight=175.124}}
 
{{#set: inchi-key=inchikey=nucljnswzchrkl-uhfffaoysa-m}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite Nucleoside-Monophosphates

  • common-name:
    • a nucleoside 5'-monophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality