Difference between revisions of "Nucleoside-Monophosphates"

Latest revision as of 19:36, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite 4-HYDROXY-L-PROLINE ==
+== Metabolite Nucleoside-Monophosphates ==
 * common-name:
-** trans-4-hydroxy-l-proline
+** a nucleoside 5'-monophosphate
-* molecular-weight:
-** 131.131
-* inchi-key:
-** pmmyeevymwasqn-dmtcnviqsa-n
-* smiles:
-** c1([n+]c(c(=o)[o-])cc(o)1)
 == Reaction(s) known to consume the compound ==
+* [[NUCLEOSIDE-PHOSPHATE-KINASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN490-3641]]
+* [[3.1.26.4-RXN]]
-* [[RXN66-546]]
+* [[3.1.4.1-RXN]]
+* [[3.1.4.17-RXN]]
+* [[3.6.1.19-RXN]]
+* [[NUCLEOSIDE-DIPHOSPHATASE-RXN]]
+* [[NUCLEOTIDE-PYROPHOSPHATASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=trans-4-hydroxy-l-proline}}
+{{#set: common-name=a nucleoside 5'-monophosphate}}
-{{#set: molecular-weight=131.131}}
-{{#set: inchi-key=inchikey=pmmyeevymwasqn-dmtcnviqsa-n}}