Difference between revisions of "Reduced-ferredoxins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE == * common-name: ** α-glucose 1,6-bisphosphate * molecular-weight: ** 336.085 * inchi-key: ** rwhozg...")
(Created page with "Category:metabolite == Metabolite Reduced-ferredoxins == * common-name: ** a reduced ferredoxin [iron-sulfur] cluster == Reaction(s) known to consume the compound == * 1...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE ==
+
== Metabolite Reduced-ferredoxins ==
 
* common-name:
 
* common-name:
** α-glucose 1,6-bisphosphate
+
** a reduced ferredoxin [iron-sulfur] cluster
* molecular-weight:
 
** 336.085
 
* inchi-key:
 
** rwhozgraxywrnx-vfuothlcsa-j
 
* smiles:
 
** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-])
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUCOSE-16-BISPHOSPHATE-SYNTHASE-RXN]]
+
* [[1.18.1.2-RXN]]
* [[RXN-16998]]
+
* [[1.3.7.4-RXN]]
 +
* [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
 +
* [[ISPH2-RXN]]
 +
* [[RXN-5061]]
 +
* [[RXN0-882]]
 +
* [[RXN0-884]]
 +
* [[RXN0-949]]
 +
* [[SULFITE-REDUCTASE-FERREDOXIN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUCOSE-16-BISPHOSPHATE-SYNTHASE-RXN]]
+
* [[1.18.1.2-RXN]]
* [[RXN-16997]]
+
* [[RXN-12878]]
 +
* [[RXN-15468]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-glucose 1,6-bisphosphate}}
+
{{#set: common-name=a reduced ferredoxin [iron-sulfur] cluster}}
{{#set: molecular-weight=336.085}}
 
{{#set: inchi-key=inchikey=rwhozgraxywrnx-vfuothlcsa-j}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite Reduced-ferredoxins

  • common-name:
    • a reduced ferredoxin [iron-sulfur] cluster

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a reduced ferredoxin [iron-sulfur] cluster" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.