Difference between revisions of "CPD-7015"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE == * common-name: ** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine * molecular-weight: ** 205.276 * inchi-key...")
(Created page with "Category:metabolite == Metabolite CPD-7015 == * common-name: ** 71-hydroxychlorophyllide a * molecular-weight: ** 628.966 * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-]...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE ==
+
== Metabolite CPD-7015 ==
 
* common-name:
 
* common-name:
** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine
+
** 71-hydroxychlorophyllide a
 
* molecular-weight:
 
* molecular-weight:
** 205.276
+
** 628.966
* inchi-key:
 
** zrjhlgyvucpznh-mqwkrirwsa-o
 
 
* smiles:
 
* smiles:
** c[n+](cccc(c(c([o-])=o)[n+])o)(c)c
+
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n(.[mg]36(.n1(=c(c(cc)=c(co)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9896]]
+
* [[RXN-7677]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7676]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hydroxy-n6,n6,n6-trimethyl-l-lysine}}
+
{{#set: common-name=71-hydroxychlorophyllide a}}
{{#set: molecular-weight=205.276}}
+
{{#set: molecular-weight=628.966}}
{{#set: inchi-key=inchikey=zrjhlgyvucpznh-mqwkrirwsa-o}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite CPD-7015

  • common-name:
    • 71-hydroxychlorophyllide a
  • molecular-weight:
    • 628.966
  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n(.[mg]36(.n1(=c(c(cc)=c(co)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality