Difference between revisions of "CPDQT-4"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HYPOTAURINE == * common-name: ** hypotaurine * molecular-weight: ** 109.143 * inchi-key: ** vviubcnyacgllv-uhfffaoysa-n * smiles: ** c([n...") |
(Created page with "Category:metabolite == Metabolite CPDQT-4 == * common-name: ** β-l-galactose 1-phosphate * molecular-weight: ** 258.121 * inchi-key: ** hxxfsfrbohsimq-sxuwkvjysa-l *...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPDQT-4 == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-l-galactose 1-phosphate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 258.121 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hxxfsfrbohsimq-sxuwkvjysa-l |
* smiles: | * smiles: | ||
| − | ** c([ | + | ** c(o)c1(c(o)c(o)c(o)c(op([o-])([o-])=o)o1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXNQT-4142]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXNQT-4141]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-l-galactose 1-phosphate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=258.121}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hxxfsfrbohsimq-sxuwkvjysa-l}} |
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite CPDQT-4
- common-name:
- β-l-galactose 1-phosphate
- molecular-weight:
- 258.121
- inchi-key:
- hxxfsfrbohsimq-sxuwkvjysa-l
- smiles:
- c(o)c1(c(o)c(o)c(o)c(op([o-])([o-])=o)o1)
