Difference between revisions of "PHE-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROXYINDOLE == * common-name: ** 5,6-dihydroxyindole * molecular-weight: ** 149.149 * inchi-key: ** sgnzyjxnuurych-uhfffaoysa-n * smi...")
(Created page with "Category:metabolite == Metabolite PHE-tRNAs == * common-name: ** a trnaphe == Reaction(s) known to consume the compound == * PHENYLALANINE--TRNA-LIGASE-RXN == Reaction...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDROXYINDOLE ==
+
== Metabolite PHE-tRNAs ==
 
* common-name:
 
* common-name:
** 5,6-dihydroxyindole
+
** a trnaphe
* molecular-weight:
 
** 149.149
 
* inchi-key:
 
** sgnzyjxnuurych-uhfffaoysa-n
 
* smiles:
 
** c1(=cnc2(=c1c=c(o)c(o)=c2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11403]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5,6-dihydroxyindole}}
+
{{#set: common-name=a trnaphe}}
{{#set: molecular-weight=149.149}}
 
{{#set: inchi-key=inchikey=sgnzyjxnuurych-uhfffaoysa-n}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite PHE-tRNAs

  • common-name:
    • a trnaphe

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality