Difference between revisions of "CPD-16758"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-HISTIDINOL-P == * common-name: ** l-histidinol phosphate * molecular-weight: ** 220.144 * inchi-key: ** cwnderhthmwbsi-yfkpbyrvsa-m * s...")
(Created page with "Category:metabolite == Metabolite CPD-16758 == * common-name: ** 2/3-phospho-d-glycerate == Reaction(s) known to consume the compound == * RXN-15509 * RXN-15512 ==...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-HISTIDINOL-P ==
+
== Metabolite CPD-16758 ==
 
* common-name:
 
* common-name:
** l-histidinol phosphate
+
** 2/3-phospho-d-glycerate
* molecular-weight:
 
** 220.144
 
* inchi-key:
 
** cwnderhthmwbsi-yfkpbyrvsa-m
 
* smiles:
 
** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+])
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HISTAMINOTRANS-RXN]]
+
* [[RXN-15509]]
* [[HISTIDPHOS-RXN]]
+
* [[RXN-15512]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTAMINOTRANS-RXN]]
+
* [[RXN-15509]]
 +
* [[RXN-15512]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-histidinol phosphate}}
+
{{#set: common-name=2/3-phospho-d-glycerate}}
{{#set: molecular-weight=220.144}}
 
{{#set: inchi-key=inchikey=cwnderhthmwbsi-yfkpbyrvsa-m}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite CPD-16758

  • common-name:
    • 2/3-phospho-d-glycerate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality