Difference between revisions of "L-ORNITHINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17347 == * common_name: ** (3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa * smiles: ** cccccc=ccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)...")
(Created page with "Category:metabolite == Metabolite L-ORNITHINE == * common-name: ** l-ornithine * molecular-weight: ** 133.17 * inchi-key: ** ahlphdhhmvztml-bypyzucnsa-o * smiles: ** c(=o)...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17347 ==
+
== Metabolite L-ORNITHINE ==
* common_name:
+
* common-name:
** (3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa
+
** l-ornithine
 +
* molecular-weight:
 +
** 133.17
 +
* inchi-key:
 +
** ahlphdhhmvztml-bypyzucnsa-o
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(=o)([o-])c([n+])ccc[n+]
* inchi_key:
 
** inchikey=mntslnsvzacncx-jpddaygwsa-j
 
* molecular_weight:
 
** 1069.99   
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16096]]
+
* [[ACETYLORNDEACET-RXN]]
 +
* [[ARGINASE-RXN]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[ORNDECARBOX-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16095]]
+
* [[ACETYLORNDEACET-RXN]]
 +
* [[ARGINASE-RXN]]
 +
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common_name=(3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa}}
+
{{#set: common-name=l-ornithine}}
{{#set: inchi_key=inchikey=mntslnsvzacncx-jpddaygwsa-j}}
+
{{#set: molecular-weight=133.17}}
{{#set: molecular_weight=1069.99    }}
+
{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}

Latest revision as of 19:36, 17 March 2021