Difference between revisions of "L-ORNITHINE"

Latest revision as of 19:36, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CDP-ETHANOLAMINE ==
+== Metabolite L-ORNITHINE ==
 * common-name:
-** cdp-ethanolamine
+** l-ornithine
 * molecular-weight:
-** 445.239
+** 133.17
 * inchi-key:
-** wvimueuqjfpndk-pebgctimsa-m
+** ahlphdhhmvztml-bypyzucnsa-o
 * smiles:
-** c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+]
+** c(=o)([o-])c([n+])ccc[n+]
 == Reaction(s) known to consume the compound ==
-* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
+* [[ACETYLORNDEACET-RXN]]
+* [[ARGINASE-RXN]]
+* [[ORNCARBAMTRANSFER-RXN]]
+* [[ORNDECARBOX-RXN]]
+* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
+* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[2.7.7.14-RXN]]
+* [[ACETYLORNDEACET-RXN]]
+* [[ARGINASE-RXN]]
+* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
+* [[ORNCARBAMTRANSFER-RXN]]
+* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
+* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=cdp-ethanolamine}}
+{{#set: common-name=l-ornithine}}
-{{#set: molecular-weight=445.239}}
+{{#set: molecular-weight=133.17}}
-{{#set: inchi-key=inchikey=wvimueuqjfpndk-pebgctimsa-m}}
+{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}