Difference between revisions of "CPD-696"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CDP-ETHANOLAMINE == * common-name: ** cdp-ethanolamine * molecular-weight: ** 445.239 * inchi-key: ** wvimueuqjfpndk-pebgctimsa-m * smile...")
(Created page with "Category:metabolite == Metabolite CPD-696 == * common-name: ** 24-methylenecycloartanol * molecular-weight: ** 440.751 * inchi-key: ** bdhqmrxfdyjgii-xpnryqhysa-n * smiles...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CDP-ETHANOLAMINE ==
+
== Metabolite CPD-696 ==
 
* common-name:
 
* common-name:
** cdp-ethanolamine
+
** 24-methylenecycloartanol
 
* molecular-weight:
 
* molecular-weight:
** 445.239
+
** 440.751
 
* inchi-key:
 
* inchi-key:
** wvimueuqjfpndk-pebgctimsa-m
+
** bdhqmrxfdyjgii-xpnryqhysa-n
 
* smiles:
 
* smiles:
** c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+]
+
** cc(c)c(=c)ccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)(c)c(o)ccc2(cc12ccc(c)34)5))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.7.14-RXN]]
+
* [[RXN-4021]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cdp-ethanolamine}}
+
{{#set: common-name=24-methylenecycloartanol}}
{{#set: molecular-weight=445.239}}
+
{{#set: molecular-weight=440.751}}
{{#set: inchi-key=inchikey=wvimueuqjfpndk-pebgctimsa-m}}
+
{{#set: inchi-key=inchikey=bdhqmrxfdyjgii-xpnryqhysa-n}}

Latest revision as of 19:36, 17 March 2021

Metabolite CPD-696

  • common-name:
    • 24-methylenecycloartanol
  • molecular-weight:
    • 440.751
  • inchi-key:
    • bdhqmrxfdyjgii-xpnryqhysa-n
  • smiles:
    • cc(c)c(=c)ccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)(c)c(o)ccc2(cc12ccc(c)34)5))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality