Difference between revisions of "D-6-P-GLUCONO-DELTA-LACTONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ASCORBATE == * common-name: ** l-ascorbate * molecular-weight: ** 175.118 * inchi-key: ** ciwbshskhkdkbq-jlaznsocsa-m * smiles: ** c(o)c(...") |
(Created page with "Category:metabolite == Metabolite D-6-P-GLUCONO-DELTA-LACTONE == * common-name: ** 6-phospho d-glucono-1,5-lactone * molecular-weight: ** 256.105 * inchi-key: ** ijojivndf...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite D-6-P-GLUCONO-DELTA-LACTONE == |
* common-name: | * common-name: | ||
− | ** | + | ** 6-phospho d-glucono-1,5-lactone |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 256.105 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ijojivndfqsgab-sqougzdysa-l |
* smiles: | * smiles: | ||
− | ** c(o) | + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[6PGLUCONOLACT-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[GLU6PDEHYDROG-RXN]] |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=6-phospho d-glucono-1,5-lactone}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=256.105}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ijojivndfqsgab-sqougzdysa-l}} |
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite D-6-P-GLUCONO-DELTA-LACTONE
- common-name:
- 6-phospho d-glucono-1,5-lactone
- molecular-weight:
- 256.105
- inchi-key:
- ijojivndfqsgab-sqougzdysa-l
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)