Difference between revisions of "D-6-P-GLUCONO-DELTA-LACTONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite T2-DECENOYL-COA == * common-name: ** (2e)-dec-2-enoyl-coa * molecular-weight: ** 915.738 * inchi-key: ** mgnbgcrqqfmnbm-yjhhllfwsa-j * sm...")
 
(Created page with "Category:metabolite == Metabolite D-6-P-GLUCONO-DELTA-LACTONE == * common-name: ** 6-phospho d-glucono-1,5-lactone * molecular-weight: ** 256.105 * inchi-key: ** ijojivndf...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite T2-DECENOYL-COA ==
+
== Metabolite D-6-P-GLUCONO-DELTA-LACTONE ==
 
* common-name:
 
* common-name:
−
** (2e)-dec-2-enoyl-coa
+
** 6-phospho d-glucono-1,5-lactone
 
* molecular-weight:
 
* molecular-weight:
−
** 915.738
+
** 256.105
 
* inchi-key:
 
* inchi-key:
−
** mgnbgcrqqfmnbm-yjhhllfwsa-j
+
** ijojivndfqsgab-sqougzdysa-l
 
* smiles:
 
* smiles:
−
** cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-13616]]
+
* [[6PGLUCONOLACT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[DIENOYLCOAREDUCT-RXN]]
+
* [[GLU6PDEHYDROG-RXN]]
−
* [[RXN-13615]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(2e)-dec-2-enoyl-coa}}
+
{{#set: common-name=6-phospho d-glucono-1,5-lactone}}
−
{{#set: molecular-weight=915.738}}
+
{{#set: molecular-weight=256.105}}
−
{{#set: inchi-key=inchikey=mgnbgcrqqfmnbm-yjhhllfwsa-j}}
+
{{#set: inchi-key=inchikey=ijojivndfqsgab-sqougzdysa-l}}

Latest revision as of 19:36, 17 March 2021

Metabolite D-6-P-GLUCONO-DELTA-LACTONE

  • common-name:
    • 6-phospho d-glucono-1,5-lactone
  • molecular-weight:
    • 256.105
  • inchi-key:
    • ijojivndfqsgab-sqougzdysa-l
  • smiles:
    • c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=D-6-P-GLUCONO-DELTA-LACTONE&oldid=49853"