Difference between revisions of "S-Substituted-Glutathione"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HOMO-CIS-ACONITATE == * common_name: ** cis-homoaconitate * smiles: ** c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-] * inchi_key: ** inchikey=bjyp...") |
(Created page with "Category:metabolite == Metabolite S-Substituted-Glutathione == * common-name: ** a glutathione-s-conjugate == Reaction(s) known to consume the compound == == Reaction(s) k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite S-Substituted-Glutathione == |
| − | * | + | * common-name: |
| − | + | ** a glutathione-s-conjugate | |
| − | |||
| − | |||
| − | |||
| − | ** | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GSHTRAN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common-name=a glutathione-s-conjugate}} |
| − | |||
| − | |||
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite S-Substituted-Glutathione
- common-name:
- a glutathione-s-conjugate
