Difference between revisions of "CPD-201"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Red-Thioredoxin == * common-name: ** a reduced thioredoxin == Reaction(s) known to consume the compound == * 1.11.1.15-RXN * 1.8.4....") |
(Created page with "Category:metabolite == Metabolite CPD-201 == * common-name: ** 4-hydroxybenzoyl-coa * molecular-weight: ** 883.61 * inchi-key: ** ltvxpvbfjbtnij-tyhxjlicsa-j * smiles: **...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-201 == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-hydroxybenzoyl-coa |
+ | * molecular-weight: | ||
+ | ** 883.61 | ||
+ | * inchi-key: | ||
+ | ** ltvxpvbfjbtnij-tyhxjlicsa-j | ||
+ | * smiles: | ||
+ | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c1(=cc=c(o)c=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-11246]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-hydroxybenzoyl-coa}} |
+ | {{#set: molecular-weight=883.61}} | ||
+ | {{#set: inchi-key=inchikey=ltvxpvbfjbtnij-tyhxjlicsa-j}} |
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite CPD-201
- common-name:
- 4-hydroxybenzoyl-coa
- molecular-weight:
- 883.61
- inchi-key:
- ltvxpvbfjbtnij-tyhxjlicsa-j
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(c1(=cc=c(o)c=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]