Difference between revisions of "CPD-201"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11602 == * common-name: ** ergosterol 3-o-β-d-glucoside * molecular-weight: ** 558.797 * inchi-key: ** mkzpngbjjjzjmi-vnwfyegesa...") |
(Created page with "Category:metabolite == Metabolite CPD-201 == * common-name: ** 4-hydroxybenzoyl-coa * molecular-weight: ** 883.61 * inchi-key: ** ltvxpvbfjbtnij-tyhxjlicsa-j * smiles: **...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-201 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-hydroxybenzoyl-coa |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 883.61 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ltvxpvbfjbtnij-tyhxjlicsa-j |
* smiles: | * smiles: | ||
| − | ** cc(c)c( | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c1(=cc=c(o)c=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11246]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-hydroxybenzoyl-coa}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=883.61}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ltvxpvbfjbtnij-tyhxjlicsa-j}} |
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite CPD-201
- common-name:
- 4-hydroxybenzoyl-coa
- molecular-weight:
- 883.61
- inchi-key:
- ltvxpvbfjbtnij-tyhxjlicsa-j
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(c1(=cc=c(o)c=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
