Difference between revisions of "TRP-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12905 == * common-name: ** 3-hydroxy-5-methylhex-4-enoyl-coa * molecular-weight: ** 889.657 * inchi-key: ** olzynlskrkfujc-fpviqycmsa...")
(Created page with "Category:metabolite == Metabolite TRP-tRNAs == * common-name: ** a trnatrp == Reaction(s) known to consume the compound == * TRYPTOPHAN--TRNA-LIGASE-RXN == Reaction(s)...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12905 ==
+
== Metabolite TRP-tRNAs ==
 
* common-name:
 
* common-name:
** 3-hydroxy-5-methylhex-4-enoyl-coa
+
** a trnatrp
* molecular-weight:
 
** 889.657
 
* inchi-key:
 
** olzynlskrkfujc-fpviqycmsa-j
 
* smiles:
 
** cc(c)=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11919]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hydroxy-5-methylhex-4-enoyl-coa}}
+
{{#set: common-name=a trnatrp}}
{{#set: molecular-weight=889.657}}
 
{{#set: inchi-key=inchikey=olzynlskrkfujc-fpviqycmsa-j}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite TRP-tRNAs

  • common-name:
    • a trnatrp

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality