Difference between revisions of "FE+3"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10794 == * common_name: ** adp ribose 1''-phosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(...")
 
(Created page with "Category:metabolite == Metabolite FE+3 == * common-name: ** fe3+ * molecular-weight: ** 55.847 * inchi-key: ** vtlyfuhaoxggbs-uhfffaoysa-n * smiles: ** [fe+++] == Reaction...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10794 ==
+
== Metabolite FE+3 ==
* common_name:
+
* common-name:
** adp ribose 1''-phosphate
+
** fe3+
 +
* molecular-weight:
 +
** 55.847
 +
* inchi-key:
 +
** vtlyfuhaoxggbs-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(o)c(o)c(o4)op(=o)([o-])[o-]))(=o)[o-]
+
** [fe+++]
* inchi_key:
 
** inchikey=cunfrfhbhmfvph-tyasjmozsa-j
 
* molecular_weight:
 
** 635.268   
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10034]]
+
* [[ExchangeSeed-FE+3]]
 +
* [[FESO3OXI-RXN]]
 +
* [[RXN-14387]]
 +
* [[TransportSeed-FE+3]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12055]]
+
* [[ExchangeSeed-FE+3]]
 +
* [[FESO3OXI-RXN]]
 +
* [[RXN-12540]]
 +
* [[RXN-12541]]
 +
* [[RXN0-1483]]
 +
* [[TransportSeed-FE+3]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common_name=adp ribose 1''-phosphate}}
+
{{#set: common-name=fe3+}}
{{#set: inchi_key=inchikey=cunfrfhbhmfvph-tyasjmozsa-j}}
+
{{#set: molecular-weight=55.847}}
{{#set: molecular_weight=635.268    }}
+
{{#set: inchi-key=inchikey=vtlyfuhaoxggbs-uhfffaoysa-n}}

Latest revision as of 19:36, 17 March 2021

Metabolite FE+3

  • common-name:
    • fe3+
  • molecular-weight:
    • 55.847
  • inchi-key:
    • vtlyfuhaoxggbs-uhfffaoysa-n
  • smiles:
    • [fe+++]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality